C22H31N3O3 — CID 97440850
[(3aR,8aR)-1-ethyl-3a-(morpholine-4-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-6-yl]-phenylmethanone (PubChem CID 97440850) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is [(3aR,8aR)-1-ethyl-3a-(morpholine-4-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-6-yl]-phenylmethanone.
| Compound Name | [(3aR,8aR)-1-ethyl-3a-(morpholine-4-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 97440850 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | [(3aR,8aR)-1-ethyl-3a-(morpholine-4-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-6-yl]-phenylmethanone |
| SMILES | CCN1CC[C@@]2(C(=O)N3CCOCC3)CCN(C(=O)c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C22H31N3O3/c1-2-23-12-9-22(21(27)25-14-16-28-17-15-25)10-13-24(11-8-19(22)23)20(26)18-6-4-3-5-7-18/h3-7,19H,2,8-17H2,1H3/t19-,22-/m1/s1 |
| InChIKey | YFNBKYZVMDODKQ-DENIHFKCSA-N |
| XLogP | 1.86 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |