C18H25NO3 — CID 162628668
1-[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-ethoxyethanone (PubChem CID 162628668) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 1-[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-ethoxyethanone.
| Compound Name | 1-[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 162628668 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1C[C@@H]2CCC[C@@](O)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C18H25NO3/c1-2-22-13-17(20)19-11-14-7-6-10-18(21,16(14)12-19)15-8-4-3-5-9-15/h3-5,8-9,14,16,21H,2,6-7,10-13H2,1H3/t14-,16+,18+/m0/s1 |
| InChIKey | DOGPWHQWJXCXEN-YXJHDRRASA-N |
| XLogP | 2.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |