C23H25NO4 — CID 135116955
[(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone (PubChem CID 135116955) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone.
| Compound Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone |
|---|---|
| PubChem CID | 135116955 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone |
| SMILES | O=C(c1cccc2c1OCCO2)N1C[C@H]2CCC[C@](O)(c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C23H25NO4/c25-22(18-9-4-10-20-21(18)28-13-12-27-20)24-14-16-6-5-11-23(26,19(16)15-24)17-7-2-1-3-8-17/h1-4,7-10,16,19,26H,5-6,11-15H2/t16-,19+,23+/m1/s1 |
| InChIKey | JEULIVPJMZAXMJ-ICPLQIHGSA-N |
| XLogP | 3.22 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |