C22H28N2O2 — CID 157016122
[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1,2,5-trimethylpyrrol-3-yl)methanone (PubChem CID 157016122) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1,2,5-trimethylpyrrol-3-yl)methanone.
| Compound Name | [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1,2,5-trimethylpyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 157016122 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1,2,5-trimethylpyrrol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2C[C@@H]3CCC[C@@](O)(c4ccccc4)[C@@H]3C2)c(C)n1C |
| InChI | InChI=1S/C22H28N2O2/c1-15-12-19(16(2)23(15)3)21(25)24-13-17-8-7-11-22(26,20(17)14-24)18-9-5-4-6-10-18/h4-6,9-10,12,17,20,26H,7-8,11,13-14H2,1-3H3/t17-,20+,22+/m0/s1 |
| InChIKey | ZOJAJTHSCJIRPZ-UCNVEGJOSA-N |
| XLogP | 3.40 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |