C23H25N5O2 — CID 135088980
[(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(tetrazol-1-ylmethyl)phenyl]methanone (PubChem CID 135088980) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(tetrazol-1-ylmethyl)phenyl]methanone.
| Compound Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(tetrazol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 135088980 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(tetrazol-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(Cn2cnnn2)cc1)N1C[C@H]2CCC[C@](O)(c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C23H25N5O2/c29-22(18-10-8-17(9-11-18)13-28-16-24-25-26-28)27-14-19-5-4-12-23(30,21(19)15-27)20-6-2-1-3-7-20/h1-3,6-11,16,19,21,30H,4-5,12-15H2/t19-,21+,23+/m1/s1 |
| InChIKey | TYHFHTMRJVKIBJ-NWSQWKLXSA-N |
| XLogP | 2.48 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |