C24H26N4O3 — CID 124824451
[(3aS,7S,7aS)-7-hydroxy-7-(3-methoxyphenyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(1,2,4-triazol-4-yl)phenyl]methanone (PubChem CID 124824451) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is [(3aS,7S,7aS)-7-hydroxy-7-(3-methoxyphenyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(1,2,4-triazol-4-yl)phenyl]methanone.
| Compound Name | [(3aS,7S,7aS)-7-hydroxy-7-(3-methoxyphenyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(1,2,4-triazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 124824451 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [(3aS,7S,7aS)-7-hydroxy-7-(3-methoxyphenyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(1,2,4-triazol-4-yl)phenyl]methanone |
| SMILES | COc1cccc([C@]2(O)CCC[C@@H]3CN(C(=O)c4ccc(-n5cnnc5)cc4)C[C@H]32)c1 |
| InChI | InChI=1S/C24H26N4O3/c1-31-21-6-2-5-19(12-21)24(30)11-3-4-18-13-27(14-22(18)24)23(29)17-7-9-20(10-8-17)28-15-25-26-16-28/h2,5-10,12,15-16,18,22,30H,3-4,11,13-14H2,1H3/t18-,22-,24-/m1/s1 |
| InChIKey | LHIGPQKPJOLXIY-IHLLOCCUSA-N |
| XLogP | 3.04 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |