C20H24N2O4S — CID 110223332
2-(4-methoxyphenyl)sulfonyl-4-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 110223332) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-4-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-4-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 110223332 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-4-pyridin-3-yl-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | COc1ccc(S(=O)(=O)N2CC3CCCC(O)(c4cccnc4)C3C2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-26-17-6-8-18(9-7-17)27(24,25)22-13-15-4-2-10-20(23,19(15)14-22)16-5-3-11-21-12-16/h3,5-9,11-12,15,19,23H,2,4,10,13-14H2,1H3 |
| InChIKey | AZNSOJOXRDDJCJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |