C21H25N3O4S — CID 124798107
N-[4-[[(3aR,7R,7aR)-7-hydroxy-7-pyridin-3-yl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]acetamide (PubChem CID 124798107) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[4-[[(3aR,7R,7aR)-7-hydroxy-7-pyridin-3-yl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[[(3aR,7R,7aR)-7-hydroxy-7-pyridin-3-yl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 124798107 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[4-[[(3aR,7R,7aR)-7-hydroxy-7-pyridin-3-yl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2C[C@@H]3CCC[C@](O)(c4cccnc4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-15(25)23-18-6-8-19(9-7-18)29(27,28)24-13-16-4-2-10-21(26,20(16)14-24)17-5-3-11-22-12-17/h3,5-9,11-12,16,20,26H,2,4,10,13-14H2,1H3,(H,23,25)/t16-,20-,21-/m0/s1 |
| InChIKey | CRZSZIYXBOGNHY-NDXORKPFSA-N |
| XLogP | 2.35 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |