C23H27FN2O2 — CID 95801381
N-[4-[[(3aS,7R,7aS)-7-(3-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]phenyl]acetamide (PubChem CID 95801381) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is N-[4-[[(3aS,7R,7aS)-7-(3-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[(3aS,7R,7aS)-7-(3-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 95801381 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | N-[4-[[(3aS,7R,7aS)-7-(3-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2C[C@H]3CCC[C@](O)(c4cccc(F)c4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C23H27FN2O2/c1-16(27)25-21-9-7-17(8-10-21)13-26-14-18-4-3-11-23(28,22(18)15-26)19-5-2-6-20(24)12-19/h2,5-10,12,18,22,28H,3-4,11,13-15H2,1H3,(H,25,27)/t18-,22-,23+/m1/s1 |
| InChIKey | UKWRYFQDPYCLDJ-YSZBQJHXSA-N |
| XLogP | 3.90 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |