C22H25FN2O4S — CID 93239022
N-[4-[[(3aR,7R,7aS)-7-(3-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]acetamide (PubChem CID 93239022) has the molecular formula C22H25FN2O4S and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[4-[[(3aR,7R,7aS)-7-(3-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[[(3aR,7R,7aS)-7-(3-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 93239022 |
| Molecular Formula | C22H25FN2O4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[4-[[(3aR,7R,7aS)-7-(3-fluorophenyl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2C[C@@H]3CCC[C@](O)(c4cccc(F)c4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C22H25FN2O4S/c1-15(26)24-19-7-9-20(10-8-19)30(28,29)25-13-16-4-3-11-22(27,21(16)14-25)17-5-2-6-18(23)12-17/h2,5-10,12,16,21,27H,3-4,11,13-14H2,1H3,(H,24,26)/t16-,21+,22-/m0/s1 |
| InChIKey | PLUKOMPHUIBSRS-USCONSEESA-N |
| XLogP | 3.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |