C21H21ClFNO2 — CID 135106968
[(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-chloro-4-fluorophenyl)methanone (PubChem CID 135106968) has the molecular formula C21H21ClFNO2 and a molecular weight of 373.86 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-chloro-4-fluorophenyl)methanone.
| Compound Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-chloro-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 135106968 |
| Molecular Formula | C21H21ClFNO2 |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-chloro-4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1C[C@H]2CCC[C@](O)(c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C21H21ClFNO2/c22-19-11-16(23)8-9-17(19)20(25)24-12-14-5-4-10-21(26,18(14)13-24)15-6-2-1-3-7-15/h1-3,6-9,11,14,18,26H,4-5,10,12-13H2/t14-,18+,21+/m1/s1 |
| InChIKey | NEQRYKBENNWQJG-IBZMOEQTSA-N |
| XLogP | 4.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |