C24H26N2O2 — CID 135120842
[(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1-methylindol-4-yl)methanone (PubChem CID 135120842) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1-methylindol-4-yl)methanone.
| Compound Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1-methylindol-4-yl)methanone |
|---|---|
| PubChem CID | 135120842 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(1-methylindol-4-yl)methanone |
| SMILES | Cn1ccc2c(C(=O)N3C[C@H]4CCC[C@](O)(c5ccccc5)[C@H]4C3)cccc21 |
| InChI | InChI=1S/C24H26N2O2/c1-25-14-12-19-20(10-5-11-22(19)25)23(27)26-15-17-7-6-13-24(28,21(17)16-26)18-8-3-2-4-9-18/h2-5,8-12,14,17,21,28H,6-7,13,15-16H2,1H3/t17-,21+,24+/m1/s1 |
| InChIKey | CYDRBBWOSYMOJO-GQOCTPOGSA-N |
| XLogP | 3.94 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |