C24H24N2O3 — CID 162636432
[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone (PubChem CID 162636432) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone.
| Compound Name | [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 162636432 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2cnco2)cc1)N1C[C@@H]2CCC[C@@](O)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C24H24N2O3/c27-23(18-10-8-17(9-11-18)22-13-25-16-29-22)26-14-19-5-4-12-24(28,21(19)15-26)20-6-2-1-3-7-20/h1-3,6-11,13,16,19,21,28H,4-5,12,14-15H2/t19-,21+,24+/m0/s1 |
| InChIKey | ALXABJOKQKZDTN-XZDHIHRUSA-N |
| XLogP | 4.10 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |