C23H23N3O3 — CID 162628912
3-[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carbonyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 162628912) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 3-[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carbonyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carbonyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 162628912 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carbonyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=C(c1cnc2ccccn2c1=O)N1C[C@@H]2CCC[C@@](O)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H23N3O3/c27-21(18-13-24-20-10-4-5-12-26(20)22(18)28)25-14-16-7-6-11-23(29,19(16)15-25)17-8-2-1-3-9-17/h1-5,8-10,12-13,16,19,29H,6-7,11,14-15H2/t16-,19+,23+/m0/s1 |
| InChIKey | BOIVTAXCOGFZCS-XKDCRVNJSA-N |
| XLogP | 2.45 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |