C20H23N3O2 — CID 135094498
[(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(6-amino-3-pyridinyl)methanone (PubChem CID 135094498) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(6-amino-3-pyridinyl)methanone.
| Compound Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(6-amino-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 135094498 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [(3aS,7R,7aR)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(6-amino-3-pyridinyl)methanone |
| SMILES | Nc1ccc(C(=O)N2C[C@H]3CCC[C@](O)(c4ccccc4)[C@H]3C2)cn1 |
| InChI | InChI=1S/C20H23N3O2/c21-18-9-8-14(11-22-18)19(24)23-12-15-5-4-10-20(25,17(15)13-23)16-6-2-1-3-7-16/h1-3,6-9,11,15,17,25H,4-5,10,12-13H2,(H2,21,22)/t15-,17+,20+/m1/s1 |
| InChIKey | IXERJSUUFRRPQA-SYNHAJSKSA-N |
| XLogP | 2.42 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |