C25H26N4O2 — CID 162633644
[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-anilinopyrimidin-5-yl)methanone (PubChem CID 162633644) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-anilinopyrimidin-5-yl)methanone.
| Compound Name | [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-anilinopyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 162633644 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(2-anilinopyrimidin-5-yl)methanone |
| SMILES | O=C(c1cnc(Nc2ccccc2)nc1)N1C[C@@H]2CCC[C@@](O)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C25H26N4O2/c30-23(19-14-26-24(27-15-19)28-21-11-5-2-6-12-21)29-16-18-8-7-13-25(31,22(18)17-29)20-9-3-1-4-10-20/h1-6,9-12,14-15,18,22,31H,7-8,13,16-17H2,(H,26,27,28)/t18-,22+,25+/m0/s1 |
| InChIKey | UAQXJAYTNDJESO-QRJOEMBSSA-N |
| XLogP | 3.98 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |