C23H24N4O2 — CID 162638087
[(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(3-pyridin-2-yl-1H-pyrazol-5-yl)methanone (PubChem CID 162638087) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(3-pyridin-2-yl-1H-pyrazol-5-yl)methanone.
| Compound Name | [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(3-pyridin-2-yl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 162638087 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(3aR,7S,7aS)-7-hydroxy-7-phenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-(3-pyridin-2-yl-1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccn2)n[nH]1)N1C[C@@H]2CCC[C@@](O)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H24N4O2/c28-22(21-13-20(25-26-21)19-10-4-5-12-24-19)27-14-16-7-6-11-23(29,18(16)15-27)17-8-2-1-3-9-17/h1-5,8-10,12-13,16,18,29H,6-7,11,14-15H2,(H,25,26)/t16-,18+,23+/m0/s1 |
| InChIKey | AOZCKDHHWBICJV-PRCFCKQXSA-N |
| XLogP | 3.23 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |