C21H20N2O3 — CID 138998156
[4-(1,3-oxazol-5-yl)phenyl]-(2-phenyl-1,4-oxazepan-4-yl)methanone (PubChem CID 138998156) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is [4-(1,3-oxazol-5-yl)phenyl]-(2-phenyl-1,4-oxazepan-4-yl)methanone.
| Compound Name | [4-(1,3-oxazol-5-yl)phenyl]-(2-phenyl-1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 138998156 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [4-(1,3-oxazol-5-yl)phenyl]-(2-phenyl-1,4-oxazepan-4-yl)methanone |
| SMILES | O=C(c1ccc(-c2cnco2)cc1)N1CCCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H20N2O3/c24-21(18-9-7-17(8-10-18)19-13-22-15-26-19)23-11-4-12-25-20(14-23)16-5-2-1-3-6-16/h1-3,5-10,13,15,20H,4,11-12,14H2 |
| InChIKey | VUJNMUGEXQXPDH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |