C23H23N3O3 — CID 155505083
[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone (PubChem CID 155505083) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone.
| Compound Name | [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 155505083 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2cnco2)cc1)N1CCN2[C@@H](COC[C@@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C23H23N3O3/c27-23(19-8-6-18(7-9-19)22-12-24-16-29-22)25-10-11-26-20(13-25)14-28-15-21(26)17-4-2-1-3-5-17/h1-9,12,16,20-21H,10-11,13-15H2/t20-,21-/m1/s1 |
| InChIKey | IKZIDVNNTAOTMR-NHCUHLMSSA-N |
| XLogP | 3.24 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |