C19H25N5O2 — CID 155495474
1-[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-(1,2,4-triazol-1-yl)butan-1-one (PubChem CID 155495474) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-(1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-(1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 155495474 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-(1,2,4-triazol-1-yl)butan-1-one |
| SMILES | O=C(CCCn1cncn1)N1CCN2[C@@H](COC[C@@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C19H25N5O2/c25-19(7-4-8-23-15-20-14-21-23)22-9-10-24-17(11-22)12-26-13-18(24)16-5-2-1-3-6-16/h1-3,5-6,14-15,17-18H,4,7-13H2/t17-,18-/m1/s1 |
| InChIKey | ZGBAKKZYUDMTNO-QZTJIDSGSA-N |
| XLogP | 1.34 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |