C21H23ClN2O3 — CID 155506207
[(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(5-chloro-2-methoxyphenyl)methanone (PubChem CID 155506207) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(5-chloro-2-methoxyphenyl)methanone.
| Compound Name | [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(5-chloro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 155506207 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [(4S,9aR)-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(5-chloro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN2[C@@H](COC[C@@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-26-20-8-7-16(22)11-18(20)21(25)23-9-10-24-17(12-23)13-27-14-19(24)15-5-3-2-4-6-15/h2-8,11,17,19H,9-10,12-14H2,1H3/t17-,19-/m1/s1 |
| InChIKey | UUYOTKYLVIYRAH-IEBWSBKVSA-N |
| XLogP | 3.25 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |