C18H20N2O3 — CID 95770737
[(5aS,8aS)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepin-5-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone (PubChem CID 95770737) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is [(5aS,8aS)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepin-5-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone.
| Compound Name | [(5aS,8aS)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepin-5-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 95770737 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [(5aS,8aS)-2,3,4,5a,6,7,8,8a-octahydrocyclopenta[b][1,4]oxazepin-5-yl]-[4-(1,3-oxazol-5-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(-c2cnco2)cc1)N1CCCO[C@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C18H20N2O3/c21-18(20-9-2-10-22-16-4-1-3-15(16)20)14-7-5-13(6-8-14)17-11-19-12-23-17/h5-8,11-12,15-16H,1-4,9-10H2/t15-,16-/m0/s1 |
| InChIKey | QFHDGWITZYSIFQ-HOTGVXAUSA-N |
| XLogP | 3.13 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |