C20H21FN2O2 — CID 163390072
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[5-(4-fluorophenyl)-3-pyridinyl]methanone (PubChem CID 163390072) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[5-(4-fluorophenyl)-3-pyridinyl]methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[5-(4-fluorophenyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 163390072 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-[5-(4-fluorophenyl)-3-pyridinyl]methanone |
| SMILES | O=C(c1cncc(-c2ccc(F)cc2)c1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C20H21FN2O2/c21-17-7-5-14(6-8-17)15-11-16(13-22-12-15)20(24)23-9-10-25-19-4-2-1-3-18(19)23/h5-8,11-13,18-19H,1-4,9-10H2 |
| InChIKey | UVIIFGIPRJIXGT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |