C21H20N2O2S — CID 154840190
(2-phenyl-1,4-oxazepan-4-yl)-(5-pyridin-3-ylthiophen-2-yl)methanone (PubChem CID 154840190) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is (2-phenyl-1,4-oxazepan-4-yl)-(5-pyridin-3-ylthiophen-2-yl)methanone.
| Compound Name | (2-phenyl-1,4-oxazepan-4-yl)-(5-pyridin-3-ylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 154840190 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2-phenyl-1,4-oxazepan-4-yl)-(5-pyridin-3-ylthiophen-2-yl)methanone |
| SMILES | O=C(c1ccc(-c2cccnc2)s1)N1CCCOC(c2ccccc2)C1 |
| InChI | InChI=1S/C21H20N2O2S/c24-21(20-10-9-19(26-20)17-8-4-11-22-14-17)23-12-5-13-25-18(15-23)16-6-2-1-3-7-16/h1-4,6-11,14,18H,5,12-13,15H2 |
| InChIKey | UOSWXVVYSZIWPA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |