C20H23NO5S — CID 110223417
1-[4-[[7-(furan-2-yl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]ethanone (PubChem CID 110223417) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 1-[4-[[7-(furan-2-yl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]ethanone.
| Compound Name | 1-[4-[[7-(furan-2-yl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 110223417 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-[4-[[7-(furan-2-yl)-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]sulfonyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CC3CCCC(O)(c4ccco4)C3C2)cc1 |
| InChI | InChI=1S/C20H23NO5S/c1-14(22)15-6-8-17(9-7-15)27(24,25)21-12-16-4-2-10-20(23,18(16)13-21)19-5-3-11-26-19/h3,5-9,11,16,18,23H,2,4,10,12-13H2,1H3 |
| InChIKey | NRGCJQTZBXTOPU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |