C17H23NO5S2 — CID 90594011
1-[4-(3-cyclohexylsulfonylazetidin-1-yl)sulfonylphenyl]ethanone (PubChem CID 90594011) has the molecular formula C17H23NO5S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-[4-(3-cyclohexylsulfonylazetidin-1-yl)sulfonylphenyl]ethanone.
| Compound Name | 1-[4-(3-cyclohexylsulfonylazetidin-1-yl)sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 90594011 |
| Molecular Formula | C17H23NO5S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-[4-(3-cyclohexylsulfonylazetidin-1-yl)sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CC(S(=O)(=O)C3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C17H23NO5S2/c1-13(19)14-7-9-16(10-8-14)25(22,23)18-11-17(12-18)24(20,21)15-5-3-2-4-6-15/h7-10,15,17H,2-6,11-12H2,1H3 |
| InChIKey | IVFQJDUXUHFCSB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |