C20H30N3O4S+ — CID 9337827
(2S)-2-[4-(4-acetylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopentylpropanamide (PubChem CID 9337827) has the molecular formula C20H30N3O4S+ and a molecular weight of 408.54 g/mol. Its IUPAC name is (2S)-2-[4-(4-acetylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopentylpropanamide.
| Compound Name | (2S)-2-[4-(4-acetylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 9337827 |
| Molecular Formula | C20H30N3O4S+ |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (2S)-2-[4-(4-acetylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopentylpropanamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CC[NH+]([C@@H](C)C(=O)NC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O4S/c1-15(20(25)21-18-5-3-4-6-18)22-11-13-23(14-12-22)28(26,27)19-9-7-17(8-10-19)16(2)24/h7-10,15,18H,3-6,11-14H2,1-2H3,(H,21,25)/p+1/t15-/m0/s1 |
| InChIKey | NNEKNJKZQYTTOF-HNNXBMFYSA-O |
| XLogP | 0.23 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |