C18H26N3O4S+ — CID 8710753
(2S)-2-[4-(4-acetylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopropylpropanamide (PubChem CID 8710753) has the molecular formula C18H26N3O4S+ and a molecular weight of 380.49 g/mol. Its IUPAC name is (2S)-2-[4-(4-acetylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopropylpropanamide.
| Compound Name | (2S)-2-[4-(4-acetylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 8710753 |
| Molecular Formula | C18H26N3O4S+ |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (2S)-2-[4-(4-acetylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopropylpropanamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CC[NH+]([C@@H](C)C(=O)NC3CC3)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O4S/c1-13(18(23)19-16-5-6-16)20-9-11-21(12-10-20)26(24,25)17-7-3-15(4-8-17)14(2)22/h3-4,7-8,13,16H,5-6,9-12H2,1-2H3,(H,19,23)/p+1/t13-/m0/s1 |
| InChIKey | MMTFYXFVYLDIQY-ZDUSSCGKSA-O |
| XLogP | -0.55 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |