C21H34N3O3S+ — CID 8514498
(2R)-N-cyclopentyl-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-ium-1-yl]propanamide (PubChem CID 8514498) has the molecular formula C21H34N3O3S+ and a molecular weight of 408.59 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-cyclopentyl-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8514498 |
| Molecular Formula | C21H34N3O3S+ |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (2R)-N-cyclopentyl-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CC[NH+]([C@H](C)C(=O)NC3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O3S/c1-16(2)18-8-10-20(11-9-18)28(26,27)24-14-12-23(13-15-24)17(3)21(25)22-19-6-4-5-7-19/h8-11,16-17,19H,4-7,12-15H2,1-3H3,(H,22,25)/p+1/t17-/m1/s1 |
| InChIKey | LTYFTIFQYZBGET-QGZVFWFLSA-O |
| XLogP | 1.15 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |