C19H29N4O4S+ — CID 8796985
N-(cyclopropylcarbamoyl)-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8796985) has the molecular formula C19H29N4O4S+ and a molecular weight of 409.53 g/mol. Its IUPAC name is N-(cyclopropylcarbamoyl)-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(cyclopropylcarbamoyl)-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8796985 |
| Molecular Formula | C19H29N4O4S+ |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-(cyclopropylcarbamoyl)-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CC[NH+](CC(=O)NC(=O)NC3CC3)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O4S/c1-14(2)15-3-7-17(8-4-15)28(26,27)23-11-9-22(10-12-23)13-18(24)21-19(25)20-16-5-6-16/h3-4,7-8,14,16H,5-6,9-13H2,1-2H3,(H2,20,21,24,25)/p+1 |
| InChIKey | SLZUIIGCRSGISL-UHFFFAOYSA-O |
| XLogP | -0.31 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |