C17H23N4O3S+ — CID 8559474
(2R)-2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopropylpropanamide (PubChem CID 8559474) has the molecular formula C17H23N4O3S+ and a molecular weight of 363.46 g/mol. Its IUPAC name is (2R)-2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopropylpropanamide.
| Compound Name | (2R)-2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 8559474 |
| Molecular Formula | C17H23N4O3S+ |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (2R)-2-[4-(2-cyanophenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclopropylpropanamide |
| SMILES | C[C@H](C(=O)NC1CC1)[NH+]1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C17H22N4O3S/c1-13(17(22)19-15-6-7-15)20-8-10-21(11-9-20)25(23,24)16-5-3-2-4-14(16)12-18/h2-5,13,15H,6-11H2,1H3,(H,19,22)/p+1/t13-/m1/s1 |
| InChIKey | AYSLBLSCRKAXFV-CYBMUJFWSA-O |
| XLogP | -0.89 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |