C13H19NO2 — CID 57265905
cis-(1R,2S)-1-(3-methoxyphenyl)-2-(methylamino)cyclopentan-1-ol (PubChem CID 57265905) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is cis-(1R,2S)-1-(3-methoxyphenyl)-2-(methylamino)cyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-1-(3-methoxyphenyl)-2-(methylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 57265905 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | cis-(1R,2S)-1-(3-methoxyphenyl)-2-(methylamino)cyclopentan-1-ol |
| SMILES | CN[C@H]1CCC[C@@]1(O)c1cccc(OC)c1 |
| InChI | InChI=1S/C13H19NO2/c1-14-12-7-4-8-13(12,15)10-5-3-6-11(9-10)16-2/h3,5-6,9,12,14-15H,4,7-8H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | JGVFFIVYEFKLIW-QWHCGFSZSA-N |
| XLogP | 1.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |