C21H26N2O4 — CID 51594942
[(3aS,4S,6aR)-4-hydroxy-4-(3-methoxyphenyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(5-propyl-1,2-oxazol-3-yl)methanone (PubChem CID 51594942) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(3aS,4S,6aR)-4-hydroxy-4-(3-methoxyphenyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(5-propyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [(3aS,4S,6aR)-4-hydroxy-4-(3-methoxyphenyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(5-propyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 51594942 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(3aS,4S,6aR)-4-hydroxy-4-(3-methoxyphenyl)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(5-propyl-1,2-oxazol-3-yl)methanone |
| SMILES | CCCc1cc(C(=O)N2C[C@@H]3CC[C@@](O)(c4cccc(OC)c4)[C@@H]3C2)no1 |
| InChI | InChI=1S/C21H26N2O4/c1-3-5-17-11-19(22-27-17)20(24)23-12-14-8-9-21(25,18(14)13-23)15-6-4-7-16(10-15)26-2/h4,6-7,10-11,14,18,25H,3,5,8-9,12-13H2,1-2H3/t14-,18+,21+/m0/s1 |
| InChIKey | RMRKAWSAQAPXQI-FIKMYACPSA-N |
| XLogP | 3.01 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |