C29H31ClN6O2 — CID 158879159
4-[6-chloro-4-(4-isocyano-4-phenylpiperidin-1-yl)quinoline-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 158879159) has the molecular formula C29H31ClN6O2 and a molecular weight of 531.06 g/mol. Its IUPAC name is 4-[6-chloro-4-(4-isocyano-4-phenylpiperidin-1-yl)quinoline-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[6-chloro-4-(4-isocyano-4-phenylpiperidin-1-yl)quinoline-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 158879159 |
| Molecular Formula | C29H31ClN6O2 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 4-[6-chloro-4-(4-isocyano-4-phenylpiperidin-1-yl)quinoline-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(c2c(C(=O)N3CCN(C(=O)N(C)C)CC3)cnc3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C29H31ClN6O2/c1-31-29(21-7-5-4-6-8-21)11-13-34(14-12-29)26-23-19-22(30)9-10-25(23)32-20-24(26)27(37)35-15-17-36(18-16-35)28(38)33(2)3/h4-10,19-20H,11-18H2,2-3H3 |
| InChIKey | JCUXRAKMMBWDGY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|