C25H28FN5OS2 — CID 174205767
[6-fluoro-4-(4-phenylsulfanylpiperazin-1-yl)quinolin-3-yl]-(4-methylsulfanylpiperazin-1-yl)methanone (PubChem CID 174205767) has the molecular formula C25H28FN5OS2 and a molecular weight of 497.67 g/mol. Its IUPAC name is [6-fluoro-4-(4-phenylsulfanylpiperazin-1-yl)quinolin-3-yl]-(4-methylsulfanylpiperazin-1-yl)methanone.
| Compound Name | [6-fluoro-4-(4-phenylsulfanylpiperazin-1-yl)quinolin-3-yl]-(4-methylsulfanylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 174205767 |
| Molecular Formula | C25H28FN5OS2 |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [6-fluoro-4-(4-phenylsulfanylpiperazin-1-yl)quinolin-3-yl]-(4-methylsulfanylpiperazin-1-yl)methanone |
| SMILES | CSN1CCN(C(=O)c2cnc3ccc(F)cc3c2N2CCN(Sc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C25H28FN5OS2/c1-33-30-13-11-29(12-14-30)25(32)22-18-27-23-8-7-19(26)17-21(23)24(22)28-9-15-31(16-10-28)34-20-5-3-2-4-6-20/h2-8,17-18H,9-16H2,1H3 |
| InChIKey | OQQLQXSSUYZKEY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|