C22H26FN5OS — CID 142581516
2-[1-[6-fluoro-3-(4-methylsulfanylpiperazine-1-carbonyl)quinolin-4-yl]piperidin-4-yl]acetonitrile (PubChem CID 142581516) has the molecular formula C22H26FN5OS and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-[1-[6-fluoro-3-(4-methylsulfanylpiperazine-1-carbonyl)quinolin-4-yl]piperidin-4-yl]acetonitrile.
| Compound Name | 2-[1-[6-fluoro-3-(4-methylsulfanylpiperazine-1-carbonyl)quinolin-4-yl]piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 142581516 |
| Molecular Formula | C22H26FN5OS |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[1-[6-fluoro-3-(4-methylsulfanylpiperazine-1-carbonyl)quinolin-4-yl]piperidin-4-yl]acetonitrile |
| SMILES | CSN1CCN(C(=O)c2cnc3ccc(F)cc3c2N2CCC(CC#N)CC2)CC1 |
| InChI | InChI=1S/C22H26FN5OS/c1-30-28-12-10-27(11-13-28)22(29)19-15-25-20-3-2-17(23)14-18(20)21(19)26-8-5-16(4-7-24)6-9-26/h2-3,14-16H,4-6,8-13H2,1H3 |
| InChIKey | XBXXHWVTBXTONE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|