C26H29FN6O3S — CID 142581270
(E)-3-cyclopropyl-2-[4-[6-fluoro-3-(4-methylsulfinylpiperazine-1-carbonyl)quinolin-4-yl]piperazine-1-carbonyl]prop-2-enenitrile (PubChem CID 142581270) has the molecular formula C26H29FN6O3S and a molecular weight of 524.62 g/mol. Its IUPAC name is (E)-3-cyclopropyl-2-[4-[6-fluoro-3-(4-methylsulfinylpiperazine-1-carbonyl)quinolin-4-yl]piperazine-1-carbonyl]prop-2-enenitrile.
| Compound Name | (E)-3-cyclopropyl-2-[4-[6-fluoro-3-(4-methylsulfinylpiperazine-1-carbonyl)quinolin-4-yl]piperazine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142581270 |
| Molecular Formula | C26H29FN6O3S |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | (E)-3-cyclopropyl-2-[4-[6-fluoro-3-(4-methylsulfinylpiperazine-1-carbonyl)quinolin-4-yl]piperazine-1-carbonyl]prop-2-enenitrile |
| SMILES | CS(=O)N1CCN(C(=O)c2cnc3ccc(F)cc3c2N2CCN(C(=O)/C(C#N)=C/C3CC3)CC2)CC1 |
| InChI | InChI=1S/C26H29FN6O3S/c1-37(36)33-12-10-32(11-13-33)26(35)22-17-29-23-5-4-20(27)15-21(23)24(22)30-6-8-31(9-7-30)25(34)19(16-28)14-18-2-3-18/h4-5,14-15,17-18H,2-3,6-13H2,1H3/b19-14+ |
| InChIKey | RFFAOOFLIUOJRG-XMHGGMMESA-N |
| XLogP | 1.93 |
| TPSA | 100.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|