C27H25FN4O2S — CID 142581226
(Z)-3-cyclopropyl-2-[4-[6-fluoro-3-(4-methylsulfinylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]prop-2-enenitrile (PubChem CID 142581226) has the molecular formula C27H25FN4O2S and a molecular weight of 488.59 g/mol. Its IUPAC name is (Z)-3-cyclopropyl-2-[4-[6-fluoro-3-(4-methylsulfinylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-cyclopropyl-2-[4-[6-fluoro-3-(4-methylsulfinylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142581226 |
| Molecular Formula | C27H25FN4O2S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (Z)-3-cyclopropyl-2-[4-[6-fluoro-3-(4-methylsulfinylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]prop-2-enenitrile |
| SMILES | CS(=O)N1CCN(C(=O)c2cnc3ccc(F)cc3c2-c2ccc(/C(C#N)=C/C3CC3)cc2)CC1 |
| InChI | InChI=1S/C27H25FN4O2S/c1-35(34)32-12-10-31(11-13-32)27(33)24-17-30-25-9-8-22(28)15-23(25)26(24)20-6-4-19(5-7-20)21(16-29)14-18-2-3-18/h4-9,14-15,17-18H,2-3,10-13H2,1H3/b21-14+ |
| InChIKey | FKWNAWROTRKAQM-KGENOOAVSA-N |
| XLogP | 4.41 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|