C27H26FN5O2 — CID 159691494
4-[6-fluoro-4-[4-(1-isocyanocyclopropyl)phenyl]quinoline-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 159691494) has the molecular formula C27H26FN5O2 and a molecular weight of 471.54 g/mol. Its IUPAC name is 4-[6-fluoro-4-[4-(1-isocyanocyclopropyl)phenyl]quinoline-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-[6-fluoro-4-[4-(1-isocyanocyclopropyl)phenyl]quinoline-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 159691494 |
| Molecular Formula | C27H26FN5O2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 4-[6-fluoro-4-[4-(1-isocyanocyclopropyl)phenyl]quinoline-3-carbonyl]-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | [C-]#[N+]C1(c2ccc(-c3c(C(=O)N4CCN(C(=O)N(C)C)CC4)cnc4ccc(F)cc34)cc2)CC1 |
| InChI | InChI=1S/C27H26FN5O2/c1-29-27(10-11-27)19-6-4-18(5-7-19)24-21-16-20(28)8-9-23(21)30-17-22(24)25(34)32-12-14-33(15-13-32)26(35)31(2)3/h4-9,16-17H,10-15H2,2-3H3 |
| InChIKey | MWLXJPVMHUAEFR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|