C22H25F2N5OS — CID 174205260
1-[6,7-difluoro-3-(4-methylsulfanylpiperazine-1-carbonyl)quinolin-4-yl]-4-methylpiperidine-4-carbonitrile (PubChem CID 174205260) has the molecular formula C22H25F2N5OS and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-[6,7-difluoro-3-(4-methylsulfanylpiperazine-1-carbonyl)quinolin-4-yl]-4-methylpiperidine-4-carbonitrile.
| Compound Name | 1-[6,7-difluoro-3-(4-methylsulfanylpiperazine-1-carbonyl)quinolin-4-yl]-4-methylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 174205260 |
| Molecular Formula | C22H25F2N5OS |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[6,7-difluoro-3-(4-methylsulfanylpiperazine-1-carbonyl)quinolin-4-yl]-4-methylpiperidine-4-carbonitrile |
| SMILES | CSN1CCN(C(=O)c2cnc3cc(F)c(F)cc3c2N2CCC(C)(C#N)CC2)CC1 |
| InChI | InChI=1S/C22H25F2N5OS/c1-22(14-25)3-5-27(6-4-22)20-15-11-17(23)18(24)12-19(15)26-13-16(20)21(30)28-7-9-29(31-2)10-8-28/h11-13H,3-10H2,1-2H3 |
| InChIKey | ZUWYESSSIAMJBE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|