C27H27F2N5O3S — CID 160790904
[6,7-difluoro-4-(4-isocyano-4-phenylpiperidin-1-yl)quinolin-3-yl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 160790904) has the molecular formula C27H27F2N5O3S and a molecular weight of 539.61 g/mol. Its IUPAC name is [6,7-difluoro-4-(4-isocyano-4-phenylpiperidin-1-yl)quinolin-3-yl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [6,7-difluoro-4-(4-isocyano-4-phenylpiperidin-1-yl)quinolin-3-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 160790904 |
| Molecular Formula | C27H27F2N5O3S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | [6,7-difluoro-4-(4-isocyano-4-phenylpiperidin-1-yl)quinolin-3-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(c2c(C(=O)N3CCN(S(C)(=O)=O)CC3)cnc3cc(F)c(F)cc23)CC1 |
| InChI | InChI=1S/C27H27F2N5O3S/c1-30-27(19-6-4-3-5-7-19)8-10-32(11-9-27)25-20-16-22(28)23(29)17-24(20)31-18-21(25)26(35)33-12-14-34(15-13-33)38(2,36)37/h3-7,16-18H,8-15H2,2H3 |
| InChIKey | SBUSGAAEHKSCQK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|