C23H26FN5O3S — CID 167408421
[5-fluoro-4-(4-isocyano-4-phenylpiperidin-1-yl)-3-pyridinyl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 167408421) has the molecular formula C23H26FN5O3S and a molecular weight of 471.56 g/mol. Its IUPAC name is [5-fluoro-4-(4-isocyano-4-phenylpiperidin-1-yl)-3-pyridinyl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [5-fluoro-4-(4-isocyano-4-phenylpiperidin-1-yl)-3-pyridinyl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 167408421 |
| Molecular Formula | C23H26FN5O3S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [5-fluoro-4-(4-isocyano-4-phenylpiperidin-1-yl)-3-pyridinyl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(c2c(F)cncc2C(=O)N2CCN(S(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C23H26FN5O3S/c1-25-23(18-6-4-3-5-7-18)8-10-27(11-9-23)21-19(16-26-17-20(21)24)22(30)28-12-14-29(15-13-28)33(2,31)32/h3-7,16-17H,8-15H2,2H3 |
| InChIKey | JINITVDNWWLBQL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|