C26H26FN5O — CID 142581187
1-[6-fluoro-3-(piperazine-1-carbonyl)quinolin-4-yl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 142581187) has the molecular formula C26H26FN5O and a molecular weight of 443.53 g/mol. Its IUPAC name is 1-[6-fluoro-3-(piperazine-1-carbonyl)quinolin-4-yl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[6-fluoro-3-(piperazine-1-carbonyl)quinolin-4-yl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 142581187 |
| Molecular Formula | C26H26FN5O |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-[6-fluoro-3-(piperazine-1-carbonyl)quinolin-4-yl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CCN(c2c(C(=O)N3CCNCC3)cnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C26H26FN5O/c27-20-6-7-23-21(16-20)24(22(17-30-23)25(33)32-14-10-29-11-15-32)31-12-8-26(18-28,9-13-31)19-4-2-1-3-5-19/h1-7,16-17,29H,8-15H2 |
| InChIKey | QTTPTGDUKXMDNG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |