C26H23ClFN3O — CID 126851117
[6-fluoro-4-(4-phenylpiperazin-1-yl)quinolin-3-yl]-phenylmethanone;hydrochloride (PubChem CID 126851117) has the molecular formula C26H23ClFN3O and a molecular weight of 447.94 g/mol. Its IUPAC name is [6-fluoro-4-(4-phenylpiperazin-1-yl)quinolin-3-yl]-phenylmethanone;hydrochloride.
| Compound Name | [6-fluoro-4-(4-phenylpiperazin-1-yl)quinolin-3-yl]-phenylmethanone;hydrochloride |
|---|---|
| PubChem CID | 126851117 |
| Molecular Formula | C26H23ClFN3O |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [6-fluoro-4-(4-phenylpiperazin-1-yl)quinolin-3-yl]-phenylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccccc1)c1cnc2ccc(F)cc2c1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H22FN3O.ClH/c27-20-11-12-24-22(17-20)25(23(18-28-24)26(31)19-7-3-1-4-8-19)30-15-13-29(14-16-30)21-9-5-2-6-10-21;/h1-12,17-18H,13-16H2;1H |
| InChIKey | YMVGQXAPOIVMEJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |