C21H22FN3O2S — CID 20882619
3-(benzenesulfonyl)-4-(4-ethylpiperazin-1-yl)-6-fluoroquinoline (PubChem CID 20882619) has the molecular formula C21H22FN3O2S and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-(4-ethylpiperazin-1-yl)-6-fluoroquinoline.
| Compound Name | 3-(benzenesulfonyl)-4-(4-ethylpiperazin-1-yl)-6-fluoroquinoline |
|---|---|
| PubChem CID | 20882619 |
| Molecular Formula | C21H22FN3O2S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-(benzenesulfonyl)-4-(4-ethylpiperazin-1-yl)-6-fluoroquinoline |
| SMILES | CCN1CCN(c2c(S(=O)(=O)c3ccccc3)cnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C21H22FN3O2S/c1-2-24-10-12-25(13-11-24)21-18-14-16(22)8-9-19(18)23-15-20(21)28(26,27)17-6-4-3-5-7-17/h3-9,14-15H,2,10-13H2,1H3 |
| InChIKey | MGSJURKIUUYOER-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |