C20H19F2N3O4S2 — CID 53491017
6-fluoro-3-(3-fluorophenyl)sulfonyl-4-(4-methylsulfonylpiperazin-1-yl)quinoline (PubChem CID 53491017) has the molecular formula C20H19F2N3O4S2 and a molecular weight of 467.52 g/mol. Its IUPAC name is 6-fluoro-3-(3-fluorophenyl)sulfonyl-4-(4-methylsulfonylpiperazin-1-yl)quinoline.
| Compound Name | 6-fluoro-3-(3-fluorophenyl)sulfonyl-4-(4-methylsulfonylpiperazin-1-yl)quinoline |
|---|---|
| PubChem CID | 53491017 |
| Molecular Formula | C20H19F2N3O4S2 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 6-fluoro-3-(3-fluorophenyl)sulfonyl-4-(4-methylsulfonylpiperazin-1-yl)quinoline |
| SMILES | CS(=O)(=O)N1CCN(c2c(S(=O)(=O)c3cccc(F)c3)cnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C20H19F2N3O4S2/c1-30(26,27)25-9-7-24(8-10-25)20-17-12-15(22)5-6-18(17)23-13-19(20)31(28,29)16-4-2-3-14(21)11-16/h2-6,11-13H,7-10H2,1H3 |
| InChIKey | XGHDYCASQQVOGJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |