C28H26FN3O3 — CID 20882587
[6-fluoro-4-[4-(2-methoxyphenyl)piperazin-1-yl]quinolin-3-yl]-(4-methoxyphenyl)methanone (PubChem CID 20882587) has the molecular formula C28H26FN3O3 and a molecular weight of 471.53 g/mol. Its IUPAC name is [6-fluoro-4-[4-(2-methoxyphenyl)piperazin-1-yl]quinolin-3-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [6-fluoro-4-[4-(2-methoxyphenyl)piperazin-1-yl]quinolin-3-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 20882587 |
| Molecular Formula | C28H26FN3O3 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | [6-fluoro-4-[4-(2-methoxyphenyl)piperazin-1-yl]quinolin-3-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cnc3ccc(F)cc3c2N2CCN(c3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C28H26FN3O3/c1-34-21-10-7-19(8-11-21)28(33)23-18-30-24-12-9-20(29)17-22(24)27(23)32-15-13-31(14-16-32)25-5-3-4-6-26(25)35-2/h3-12,17-18H,13-16H2,1-2H3 |
| InChIKey | TVXFZXCLOMLELU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |