C26H32N4O4 — CID 122183782
N-[3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-6-methoxyquinoline-3-carboxamide (PubChem CID 122183782) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-6-methoxyquinoline-3-carboxamide.
| Compound Name | N-[3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-6-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 122183782 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | N-[3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-6-methoxyquinoline-3-carboxamide |
| SMILES | COc1ccc2ncc(C(=O)NCCC(O)CN3CCN(c4ccccc4OC)CC3)cc2c1 |
| InChI | InChI=1S/C26H32N4O4/c1-33-22-7-8-23-19(16-22)15-20(17-28-23)26(32)27-10-9-21(31)18-29-11-13-30(14-12-29)24-5-3-4-6-25(24)34-2/h3-8,15-17,21,31H,9-14,18H2,1-2H3,(H,27,32) |
| InChIKey | CHORKXOAHORPHG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |