C25H30N4O3 — CID 122183783
N-[3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-7-carboxamide (PubChem CID 122183783) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-7-carboxamide.
| Compound Name | N-[3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 122183783 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-7-carboxamide |
| SMILES | COc1ccccc1N1CCN(CC(O)CCNC(=O)c2ccc3cccnc3c2)CC1 |
| InChI | InChI=1S/C25H30N4O3/c1-32-24-7-3-2-6-23(24)29-15-13-28(14-16-29)18-21(30)10-12-27-25(31)20-9-8-19-5-4-11-26-22(19)17-20/h2-9,11,17,21,30H,10,12-16,18H2,1H3,(H,27,31) |
| InChIKey | NVECQJGBKKFGEZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |