C23H25ClN6O — CID 71825143
[6-chloro-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-3-yl]-piperidin-1-ylmethanone (PubChem CID 71825143) has the molecular formula C23H25ClN6O and a molecular weight of 436.95 g/mol. Its IUPAC name is [6-chloro-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [6-chloro-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 71825143 |
| Molecular Formula | C23H25ClN6O |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [6-chloro-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1cnc2ccc(Cl)cc2c1N1CCN(c2ncccn2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C23H25ClN6O/c24-17-5-6-20-18(15-17)21(19(16-27-20)22(31)29-9-2-1-3-10-29)28-11-13-30(14-12-28)23-25-7-4-8-26-23/h4-8,15-16H,1-3,9-14H2 |
| InChIKey | PXRUWGSSVOXGHH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |